CAS No: 6208-60-2, Chemical Name: 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole
the physical and chemical property of 6208-60-2, 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole is provided by ChemNet.com
ChemNet > CAS > 6208-60-2 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole
6208-60-2 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole
| produktnavn |
2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole |
| Synonymer |
1H-Pyrido[4,3-b]indole, 2,3,4,5-tetrahydro-; 2,3,4,5-Tetrahydro-1H-pyrido[4,3-b]indole; 2,3,4,5-Tetrahydrl-1H-pyrido[4,3-b]indole |
| Molekylær Formel |
C11H12N2 |
| Molekylvekt |
172.2264 |
| InChI |
InChI=1/C11H12N2/c1-2-4-10-8(3-1)9-7-12-6-5-11(9)13-10/h1-4,12-13H,5-7H2 |
| CAS-nummer |
6208-60-2 |
| Molecular Structure |
![6208-60-2 2,3,4,5-Tetrahydro-1H-pyrido[4,3,b]indole](https://images-a.chemnet.com/suppliers/chembase/cas/cas6208-60-2.gif)
|
| Tetthet |
1.189g/cm3 |
| Kokepunkt |
351.6°C at 760 mmHg |
| Brytningsindeks |
1.669 |
| Flammepunktet |
166.5°C |
| Hazard symboler |
|
| Risiko Koder |
|
| Sikkerhet Beskrivelse |
|
|
